![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Police Truck.mp3 | 2023-03-29 23:28 | 5.3M | |
| 02. Too Drunk To Fuck.mp3 | 2023-03-29 23:28 | 8.4M | |
| 03. Halloween.mp3 | 2023-03-29 23:28 | 12M | |
| 04. Let's Lynch the Landlord.mp3 | 2023-03-29 23:28 | 6.6M | |
| 05. Nazi Punks Fuck Off.mp3 | 2023-03-29 23:28 | 3.1M | |
| 06. Forward To Death.mp3 | 2023-03-29 23:28 | 2.8M | |
| 07. Chemical Warfare.mp3 | 2023-03-29 23:28 | 8.1M | |
| 08. Saturday Night Holocaust.mp3 | 2023-03-29 23:28 | 16M | |
| 09. Moon Over Marin.mp3 | 2023-03-29 23:28 | 13M | |
| 10. Ill In The Head.mp3 | 2023-03-29 23:28 | 6.2M | |
| 11. California Uber Alles.mp3 | 2023-03-29 23:28 | 11M | |
| 12. Winnebago Warrior.mp3 | 2023-03-29 23:28 | 8.0M | |
| 13. Drug Me.mp3 | 2023-03-29 23:28 | 4.2M | |
| 14. Insight.mp3 | 2023-03-29 23:28 | 7.1M | |
| 15. Let's Lynch The Landlord.mp3 | 2023-03-29 23:28 | 4.6M | |
| 16. Holiday In Cambodia.mp3 | 2023-03-29 23:28 | 9.8M | |
| back.jpg | 2023-03-29 23:28 | 2.4M | |
| disk.jpg | 2023-03-29 23:28 | 1.8M | |
| front.jpg | 2023-03-29 23:28 | 580K | |
| inley.jpg | 2023-03-29 23:28 | 2.0M | |
