![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Kill the Poor.mp3 | 2023-03-29 23:28 | 7.0M | |
| 02. Forward to Death.mp3 | 2023-03-29 23:28 | 3.1M | |
| 03. When Ya Get Drafted.mp3 | 2023-03-29 23:28 | 3.1M | |
| 04. Let's Lynch the Landlord.mp3 | 2023-03-29 23:28 | 5.0M | |
| 05. Drug Me.mp3 | 2023-03-29 23:28 | 4.4M | |
| 06. Your Emotions.mp3 | 2023-03-29 23:28 | 3.0M | |
| 07. Chemical Welfare.mp3 | 2023-03-29 23:28 | 6.7M | |
| 08. California Uber Alles.mp3 | 2023-03-29 23:28 | 6.9M | |
| 09. I Kill Children.mp3 | 2023-03-29 23:28 | 4.7M | |
| 10. Stealing People's Mail.mp3 | 2023-03-29 23:28 | 3.5M | |
| 11. Funland at the Beach.mp3 | 2023-03-29 23:28 | 4.1M | |
| 12. Ill in the Head.mp3 | 2023-03-29 23:28 | 6.2M | |
| 13. Holiday in Cambodia.mp3 | 2023-03-29 23:28 | 10M | |
| 14. Viva Las Vegas.mp3 | 2023-03-29 23:28 | 6.0M | |
| disk.jpg | 2023-03-29 23:28 | 521K | |
| front.jpg | 2023-03-29 23:28 | 937K | |
| inley.jpg | 2023-03-29 23:28 | 1.8M | |
| insert.jpg | 2023-03-29 23:28 | 3.3M | |
