![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Holiday In Cambodia.mp3 | 2023-03-29 23:28 | 5.7M | |
| 02 Let's Lynch The Landlord.mp3 | 2023-03-29 23:28 | 3.8M | |
| 03 Chemical Warfare.mp3 | 2023-03-29 23:28 | 6.7M | |
| 04 Nazi Punks Fuck Off.mp3 | 2023-03-29 23:28 | 2.2M | |
| 05 We've Got A Bigger Problem Now.mp3 | 2023-03-29 23:28 | 5.9M | |
| 06 Too Trunk To Fuck.mp3 | 2023-03-29 23:28 | 5.9M | |
| 07 Kill The Poor.mp3 | 2023-03-29 23:28 | 4.5M | |
| 08 Man With A Dog.mp3 | 2023-03-29 23:28 | 4.3M | |
| 09 Forward To Death.mp3 | 2023-03-29 23:28 | 1.5M | |
| 10 Kepone Factory.mp3 | 2023-03-29 23:28 | 2.5M | |
| 11 Life Sentence.mp3 | 2023-03-29 23:28 | 4.5M | |
| 12 Trust Your Mechanic.mp3 | 2023-03-29 23:28 | 4.5M | |
| 13 Moral Majority.mp3 | 2023-03-29 23:28 | 3.6M | |
| 14 Forest Fire.mp3 | 2023-03-29 23:28 | 2.7M | |
| 15 Winnebago Warrior.mp3 | 2023-03-29 23:28 | 3.2M | |
| 16 Police Jerk.mp3 | 2023-03-29 23:28 | 4.5M | |
| 17 Bleed For Me.mp3 | 2023-03-29 23:28 | 4.2M | |