![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - The Requiem.mp3 | 2022-05-29 19:46 | 4.6M | |
| 02 - The Radiance.mp3 | 2022-05-29 19:46 | 2.2M | |
| 03 - Burning In The Skies.mp3 | 2022-05-29 19:46 | 9.7M | |
| 04 - Empty Spaces.mp3 | 2022-05-29 19:46 | 726K | |
| 05 - When They Come For Me.mp3 | 2022-05-29 19:46 | 11M | |
| 06 - Robot Boy.mp3 | 2022-05-29 19:46 | 10M | |
| 07 - Jornada Del Muerto.mp3 | 2022-05-29 19:46 | 3.6M | |
| 08 - Waiting For The End.mp3 | 2022-05-29 19:46 | 8.8M | |
| 09 - Blackout.mp3 | 2022-05-29 19:46 | 11M | |
| 10 - Wretches And Kings.mp3 | 2022-05-29 19:46 | 9.6M | |
| 11 - Wisdom, Justice, And Love.mp3 | 2022-05-29 19:46 | 3.8M | |
| 12 - Iridescent.mp3 | 2022-05-29 19:46 | 11M | |
| 13 - Fallout.mp3 | 2022-05-29 19:46 | 3.2M | |
| 14 - The Catalyst.mp3 | 2022-05-29 19:46 | 13M | |
| 15 - The Messenger.mp3 | 2022-05-29 19:46 | 6.9M | |
| HMV Exlusive Bonus Track/ | 2022-05-29 19:46 | - | |
| Japan Edition Bonus Track/ | 2022-05-29 19:46 | - | |
| cover.jpg | 2022-05-29 19:46 | 26K | |
| covers/ | 2022-05-29 19:46 | - | |