![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Everyone I Went To High School With Is Dead.flac | 2024-10-22 00:07 | 16M | |
| 02. Chemical Marriage.flac | 2024-10-22 00:07 | 17M | |
| 03. Carry Stress In The Jaw.flac | 2024-10-22 00:07 | 50M | |
| 04. Desert Search For Techno Allah.flac | 2024-10-22 00:07 | 32M | |
| 05. Violenza Domestica.flac | 2024-10-22 00:07 | 27M | |
| 06. After School Special.flac | 2024-10-22 00:07 | 14M | |
| 07. Phlegmatics.flac | 2024-10-22 00:07 | 17M | |
| 08. Ma Meeshka Mow Skwoz.flac | 2024-10-22 00:07 | 32M | |
| 09. The Bends.flac | 2024-10-22 00:07 | 46M | |
| 10. Backstrokin’.flac | 2024-10-22 00:06 | 13M | |
| 11. Platypus.flac | 2024-10-22 00:07 | 31M | |
| 12. Merry Go Bye Bye.flac | 2024-10-22 00:07 | 71M | |
| Artwork/ | 2025-07-04 01:09 | - | |
| Cover.jpg | 2024-10-22 00:04 | 574K | |
| Disco Volante.cue | 2024-10-22 00:04 | 2.1K | |
| Disco Volante.log | 2024-10-22 00:04 | 14K | |