![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 10 Wrong One to Fuck With.mp3 | 2023-05-18 21:55 | 11M | |
| 09 Unmitigated Detestation.mp3 | 2023-05-18 21:55 | 12M | |
| 02 Panic Amongst the Herd.mp3 | 2023-05-18 21:55 | 7.7M | |
| 01 Fixated on Devastation.mp3 | 2023-05-18 21:55 | 9.5M | |
| 05 Seething with Disdain.mp3 | 2023-05-18 21:55 | 13M | |
| 04 Reveling in the Abyss.mp3 | 2023-05-18 21:55 | 15M | |
| 03 Die with Integrity.mp3 | 2023-05-18 21:55 | 12M | |
| 11 Induce Terror (Bonus Track).mp3 | 2023-05-18 21:55 | 10M | |
| 07 Weaken The Structure.mp3 | 2023-05-18 21:55 | 12M | |
| 08 Fallacy.mp3 | 2023-05-18 21:55 | 10M | |
| 06 Ideological Subjugation.mp3 | 2023-05-18 21:55 | 12M | |
| Cover.jpg | 2023-05-18 21:55 | 420K | |
